CAS 1367552-51-9 is the registry number for Di-tert-butyl (S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate (CAS 1367552-51-9) is a chemical compound with the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. IUPAC name: ditert-butyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: SFMXNWPUYIFXIV-LLVKDONJSA-N.
| Molecular formula | C16H27NO5 |
|---|---|
| Molecular weight | 313.39 g/mol |
| IUPAC name | ditert-butyl (2S)-3,3-dimethyl-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | SFMXNWPUYIFXIV-LLVKDONJSA-N |
| SMILES | CC1([C@H](N(CC1=O)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)