Products 2084812-28-0

CAS 2084812-28-0 is the registry number for 8-(tert-Butyl) 2-ethyl 3-methoxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 2-O-ethyl 3-methoxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 2084812-28-0) is a chemical compound with the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. IUPAC name: 8-O-tert-butyl 2-O-ethyl 3-methoxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: PAUQTJGCPUGLND-UHFFFAOYSA-N.

Identity
Molecular formulaC16H27NO5
Molecular weight313.39 g/mol
IUPAC name8-O-tert-butyl 2-O-ethyl 3-methoxy-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate
InChIKeyPAUQTJGCPUGLND-UHFFFAOYSA-N
SMILESCCOC(=O)C1C2CCC(N2C(=O)OC(C)(C)C)CC1OC

Computed by PubChem (NCBI)