Products 2920763-32-0

CAS 2920763-32-0 is the registry number for Di-tert-butyl 4-formylpiperidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ditert-butyl 4-formylpiperidine-1,2-dicarboxylate (CAS 2920763-32-0) is a chemical compound with the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. IUPAC name: ditert-butyl 4-formylpiperidine-1,2-dicarboxylate. InChIKey: LNWIUIOKPMQVMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H27NO5
Molecular weight313.39 g/mol
IUPAC nameditert-butyl 4-formylpiperidine-1,2-dicarboxylate
InChIKeyLNWIUIOKPMQVMJ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1CC(CCN1C(=O)OC(C)(C)C)C=O

Computed by PubChem (NCBI)