Products 136765-49-6
CAS 136765-49-6 appears in our catalog under these names: rac-Propoxyphene-D5 0.1 mg/ml in Acetonitrile, rac-Propoxyphene-D5 1.0 mg/ml in Acetonitrile. Offered by: LoGiCal. Available pack sizes: 1ml.
[4-(dimethylamino)-3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylbutan-2-yl] propanoate (CAS 136765-49-6) is a chemical compound with the molecular formula C22H29NO2 and a molecular weight of 344.5 g/mol. IUPAC name: [4-(dimethylamino)-3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylbutan-2-yl] propanoate. InChIKey: XLMALTXPSGQGBX-WVDYZBLBSA-N.
| Molecular formula | C22H29NO2 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | [4-(dimethylamino)-3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylbutan-2-yl] propanoate |
| InChIKey | XLMALTXPSGQGBX-WVDYZBLBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CC2=CC=CC=C2)(C(C)CN(C)C)OC(=O)CC)[2H])[2H] |
Computed by PubChem (NCBI)