CAS 214601-12-4 appears in our catalog under these names: Fesoterodine Impurity 10, 3-((1R)-3-(Bis(1-methylethyl)amino)-1-phenylpropyl)-4-hydroxy-benzaldehyde. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzaldehyde (CAS 214601-12-4) is a chemical compound with the molecular formula C22H29NO2 and a molecular weight of 339.5 g/mol. IUPAC name: 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzaldehyde. InChIKey: DHTHWYZNJZNTIT-HXUWFJFHSA-N.
| Molecular formula | C22H29NO2 |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzaldehyde |
| InChIKey | DHTHWYZNJZNTIT-HXUWFJFHSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)C=O)O)C(C)C |
Computed by PubChem (NCBI)