Products 136765-50-9
CAS 136765-50-9 is the registry number for Protriptyline-d3. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-N-(trideuteriomethyl)propan-1-amine (CAS 136765-50-9) is a chemical compound with the molecular formula C19H21N and a molecular weight of 266.4 g/mol. IUPAC name: 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-N-(trideuteriomethyl)propan-1-amine. InChIKey: BWPIARFWQZKAIA-FIBGUPNXSA-N.
| Molecular formula | C19H21N |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)-N-(trideuteriomethyl)propan-1-amine |
| InChIKey | BWPIARFWQZKAIA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCCC1C2=CC=CC=C2C=CC3=CC=CC=C13 |
Computed by PubChem (NCBI)