CAS 1367932-46-4 appears in our catalog under these names: 2-(1-((tert-Butoxy)carbonyl)pyrrolidin-3-yl)propanoic acid, 95%, 2-(1-((tert-Butoxy)carbonyl)pyrrolidin-3-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]propanoic acid (CAS 1367932-46-4) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]propanoic acid. InChIKey: FRYFRZPDMHRDDH-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]propanoic acid |
| InChIKey | FRYFRZPDMHRDDH-UHFFFAOYSA-N |
| SMILES | CC(C1CCN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)