CAS 1367943-38-1 appears in our catalog under these names: (3-Phenylisothiazol-5-yl)methanamine, 95.0%, (3-Phenyl-1,2-thiazol-5-yl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3-phenyl-1,2-thiazol-5-yl)methanamine (CAS 1367943-38-1) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: (3-phenyl-1,2-thiazol-5-yl)methanamine. InChIKey: KCTFFVBSAKUXLG-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | (3-phenyl-1,2-thiazol-5-yl)methanamine |
| InChIKey | KCTFFVBSAKUXLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=C2)CN |
Computed by PubChem (NCBI)