CAS 1368042-75-4 is the registry number for 5-Bromo-6-methoxy-1,2,3,4-tetrahydroisoquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinoline (CAS 1368042-75-4) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 5-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinoline. InChIKey: GAEIUEFZUZSDOV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 5-bromo-6-methoxy-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | GAEIUEFZUZSDOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CNCC2)C=C1)Br |
Computed by PubChem (NCBI)