Products 1368231-10-0
CAS 1368231-10-0 is the registry number for Rel-tert-butyl (3aR,7aR)-octahydro-1H-pyrrolo[2,3-c]pyridine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate (CAS 1368231-10-0) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate. InChIKey: KFOSBANHALBORK-ZJUUUORDSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (3aR,7aR)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridine-1-carboxylate |
| InChIKey | KFOSBANHALBORK-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@@H]1CNCC2 |
Computed by PubChem (NCBI)