Products 136832-75-2

CAS 136832-75-2 is the registry number for Boc-L-Lys-OMe AcOH, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

Acetic acid;methyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CAS 136832-75-2) is a chemical compound with the molecular formula C14H28N2O6 and a molecular weight of 320.38 g/mol. IUPAC name: acetic acid;methyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate. InChIKey: IQQHZKIYBAMWEX-FVGYRXGTSA-N.

Identity
Molecular formulaC14H28N2O6
Molecular weight320.38 g/mol
IUPAC nameacetic acid;methyl (2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate
InChIKeyIQQHZKIYBAMWEX-FVGYRXGTSA-N
SMILESCC(=O)O.CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)OC

Computed by PubChem (NCBI)