Products 2940948-94-5

CAS 2940948-94-5 is the registry number for 2-(aminomethyl)cyclopentanol,hemi(oxalic acid), 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Bis(2-(aminomethyl)cyclopentan-1-ol);oxalic acid (CAS 2940948-94-5) is a chemical compound with the molecular formula C14H28N2O6 and a molecular weight of 320.38 g/mol. IUPAC name: bis(2-(aminomethyl)cyclopentan-1-ol);oxalic acid. InChIKey: AYTTVWJEDXHTMM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H28N2O6
Molecular weight320.38 g/mol
IUPAC namebis(2-(aminomethyl)cyclopentan-1-ol);oxalic acid
InChIKeyAYTTVWJEDXHTMM-UHFFFAOYSA-N
SMILESC1CC(C(C1)O)CN.C1CC(C(C1)O)CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)