CAS 2940948-94-5 is the registry number for 2-(aminomethyl)cyclopentanol,hemi(oxalic acid), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(2-(aminomethyl)cyclopentan-1-ol);oxalic acid (CAS 2940948-94-5) is a chemical compound with the molecular formula C14H28N2O6 and a molecular weight of 320.38 g/mol. IUPAC name: bis(2-(aminomethyl)cyclopentan-1-ol);oxalic acid. InChIKey: AYTTVWJEDXHTMM-UHFFFAOYSA-N.
| Molecular formula | C14H28N2O6 |
|---|---|
| Molecular weight | 320.38 g/mol |
| IUPAC name | bis(2-(aminomethyl)cyclopentan-1-ol);oxalic acid |
| InChIKey | AYTTVWJEDXHTMM-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)O)CN.C1CC(C(C1)O)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)