Products 2940861-90-3
CAS 2940861-90-3 is the registry number for (1R,3S)-3-Amino-1-methylcyclopentan-1-ol oxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Oxalic acid;bis(trans-(1R,3S)-3-amino-1-methylcyclopentan-1-ol) (CAS 2940861-90-3) is a chemical compound with the molecular formula C14H28N2O6 and a molecular weight of 320.38 g/mol. IUPAC name: oxalic acid;bis(trans-(1R,3S)-3-amino-1-methylcyclopentan-1-ol). InChIKey: LYHZCOBDHZELRL-SMKNNOOGSA-N.
| Molecular formula | C14H28N2O6 |
|---|---|
| Molecular weight | 320.38 g/mol |
| IUPAC name | oxalic acid;bis(trans-(1R,3S)-3-amino-1-methylcyclopentan-1-ol) |
| InChIKey | LYHZCOBDHZELRL-SMKNNOOGSA-N |
| SMILES | C[C@]1(CC[C@@H](C1)N)O.C[C@]1(CC[C@@H](C1)N)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)