CAS 1368345-17-8 appears in our catalog under these names: 3-(2,2,2-Trifluoroethyl)benzaldehyde, 95%, 3-(2,2,2-Trifluoroethyl)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
3-(2,2,2-trifluoroethyl)benzaldehyde (CAS 1368345-17-8) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 3-(2,2,2-trifluoroethyl)benzaldehyde. InChIKey: OSUXZCYXCQPRGJ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethyl)benzaldehyde |
| InChIKey | OSUXZCYXCQPRGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C=O)CC(F)(F)F |
Computed by PubChem (NCBI)