Products 1368369-97-4
CAS 1368369-97-4 is the registry number for 1-{Thieno(2,3-c)pyridin-2-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-thieno[2,3-c]pyridin-2-ylethanone (CAS 1368369-97-4) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 1-thieno[2,3-c]pyridin-2-ylethanone. InChIKey: IDGAFMKNYJNWLE-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 1-thieno[2,3-c]pyridin-2-ylethanone |
| InChIKey | IDGAFMKNYJNWLE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(S1)C=NC=C2 |
Computed by PubChem (NCBI)