CAS 136871-75-5 is the registry number for (2S,3S)-(-)-3-Amino-2-phenylpiperidine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
(2S,3S)-2-phenylpiperidin-3-amine (CAS 136871-75-5) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: (2S,3S)-2-phenylpiperidin-3-amine. InChIKey: GFMAFYNUQDLPBP-QWRGUYRKSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | (2S,3S)-2-phenylpiperidin-3-amine |
| InChIKey | GFMAFYNUQDLPBP-QWRGUYRKSA-N |
| SMILES | C1C[C@@H]([C@@H](NC1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)