CAS 160551-72-4 is the registry number for Cis-2-phenylpiperidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-phenylpiperidin-3-amine (CAS 160551-72-4) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: (2R,3R)-2-phenylpiperidin-3-amine. InChIKey: GFMAFYNUQDLPBP-GHMZBOCLSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | (2R,3R)-2-phenylpiperidin-3-amine |
| InChIKey | GFMAFYNUQDLPBP-GHMZBOCLSA-N |
| SMILES | C1C[C@H]([C@H](NC1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)