CAS 161167-79-9 is the registry number for (2R,3R)–2–phenylpiperidin–3–amine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(2R,3R)-2-phenylpiperidin-3-amine (CAS 161167-79-9) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: (2R,3R)-2-phenylpiperidin-3-amine. InChIKey: GFMAFYNUQDLPBP-GHMZBOCLSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | (2R,3R)-2-phenylpiperidin-3-amine |
| InChIKey | GFMAFYNUQDLPBP-GHMZBOCLSA-N |
| SMILES | C1C[C@H]([C@H](NC1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)