CAS 136884-86-1 is the registry number for Hexobarbital-D3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
5-(cyclohexen-1-yl)-1-methyl-5-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione (CAS 136884-86-1) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 239.29 g/mol. IUPAC name: 5-(cyclohexen-1-yl)-1-methyl-5-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione. InChIKey: UYXAWHWODHRRMR-FIBGUPNXSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 5-(cyclohexen-1-yl)-1-methyl-5-(trideuteriomethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | UYXAWHWODHRRMR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1(C(=O)NC(=O)N(C1=O)C)C2=CCCCC2 |
Computed by PubChem (NCBI)