Products 1368950-70-2
CAS 1368950-70-2 is the registry number for 3,4,6-Trimethyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,4,6-trimethyl-1H-indole-2-carboxylic acid (CAS 1368950-70-2) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 3,4,6-trimethyl-1H-indole-2-carboxylic acid. InChIKey: AQQQJQXOHCZKFB-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 3,4,6-trimethyl-1H-indole-2-carboxylic acid |
| InChIKey | AQQQJQXOHCZKFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C(NC2=C1)C(=O)O)C)C |
Computed by PubChem (NCBI)