CAS 1369042-74-9 is the registry number for 7-Bromo-3,3-dimethylindolin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-3,3-dimethyl-1H-indol-2-one (CAS 1369042-74-9) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 7-bromo-3,3-dimethyl-1H-indol-2-one. InChIKey: ZRYMHHQESIFOLE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 7-bromo-3,3-dimethyl-1H-indol-2-one |
| InChIKey | ZRYMHHQESIFOLE-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)Br)NC1=O)C |
Computed by PubChem (NCBI)