Products 1369094-48-3
CAS 1369094-48-3 is the registry number for 5-Oxo-1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-7-carboxylic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-7-carboxylic acid (CAS 1369094-48-3) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-7-carboxylic acid. InChIKey: OZFAGBWCAYXVRE-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 5-oxo-2,3-dihydro-1H-imidazo[1,2-a]pyridine-7-carboxylic acid |
| InChIKey | OZFAGBWCAYXVRE-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=CC2=O)C(=O)O)N1 |
Computed by PubChem (NCBI)