Products 1369152-09-9

CAS 1369152-09-9 is the registry number for 2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid (CAS 1369152-09-9) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: 2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid. InChIKey: JMLLGPTZXJDAIE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O3
Molecular weight184.23 g/mol
IUPAC name2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid
InChIKeyJMLLGPTZXJDAIE-UHFFFAOYSA-N
SMILESC1CC2(C1)CC(CCO2)CC(=O)O

Computed by PubChem (NCBI)