Products 1369239-66-6
CAS 1369239-66-6 is the registry number for Rel-tert-butyl (3aS,7aS)-octahydro-5H-pyrrolo[3,2-c]pyridine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine-5-carboxylate (CAS 1369239-66-6) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine-5-carboxylate. InChIKey: NVINVTWMFWHTFK-NXEZZACHSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine-5-carboxylate |
| InChIKey | NVINVTWMFWHTFK-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@@H](C1)CCN2 |
Computed by PubChem (NCBI)