Products 1369265-53-1
CAS 1369265-53-1 appears in our catalog under these names: Ethyl 3-(phenylamino)benzoate, 95%, Ethyl 3–(phenylamino)benzoate, Ethyl 3-(phenylamino)benzoate, 98%, 98%, Ethyl 3-(phenylamino)benzoate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g.
Ethyl 3-anilinobenzoate (CAS 1369265-53-1) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: ethyl 3-anilinobenzoate. InChIKey: IFERRBZMLVXUEE-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | ethyl 3-anilinobenzoate |
| InChIKey | IFERRBZMLVXUEE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)