CAS 1369341-62-7 is the registry number for 2-Methylpyrazolo(1,5-a)pyrimidine-7-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.
2-methylpyrazolo[1,5-a]pyrimidine-7-carboxylic acid (CAS 1369341-62-7) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 2-methylpyrazolo[1,5-a]pyrimidine-7-carboxylic acid. InChIKey: RPDNYRSXVUZMTB-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-methylpyrazolo[1,5-a]pyrimidine-7-carboxylic acid |
| InChIKey | RPDNYRSXVUZMTB-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=CC=NC2=C1)C(=O)O |
Computed by PubChem (NCBI)