CAS 1369530-16-4 is the registry number for rel-Methyl (2R,3S)-2-methylpiperidine-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
Methyl (2R,3S)-2-methylpiperidine-3-carboxylate (CAS 1369530-16-4) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: methyl (2R,3S)-2-methylpiperidine-3-carboxylate. InChIKey: ZORUKIWYFWDAKK-RQJHMYQMSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | methyl (2R,3S)-2-methylpiperidine-3-carboxylate |
| InChIKey | ZORUKIWYFWDAKK-RQJHMYQMSA-N |
| SMILES | C[C@@H]1[C@H](CCCN1)C(=O)OC |
Computed by PubChem (NCBI)