CAS 1864003-05-3 appears in our catalog under these names: Methyl (2R,3R)–2–Methylpiperidine–3–carboxylate, Methyl (2R,3R)-2-methylpiperidine-3-carboxylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2R,3R)-2-methylpiperidine-3-carboxylate (CAS 1864003-05-3) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: methyl (2R,3R)-2-methylpiperidine-3-carboxylate. InChIKey: ZORUKIWYFWDAKK-RNFRBKRXSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | methyl (2R,3R)-2-methylpiperidine-3-carboxylate |
| InChIKey | ZORUKIWYFWDAKK-RNFRBKRXSA-N |
| SMILES | C[C@@H]1[C@@H](CCCN1)C(=O)OC |
Computed by PubChem (NCBI)