CAS 1369784-97-3 is the registry number for 3-Amino-5-bromo-N,N-dimethylbenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-amino-5-bromo-N,N-dimethylbenzamide (CAS 1369784-97-3) is a chemical compound with the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. IUPAC name: 3-amino-5-bromo-N,N-dimethylbenzamide. InChIKey: PJJBQBSUZZRHLX-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 3-amino-5-bromo-N,N-dimethylbenzamide |
| InChIKey | PJJBQBSUZZRHLX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)N |
Computed by PubChem (NCBI)