Products 1369785-64-7

CAS 1369785-64-7 is the registry number for 2-Chloro-3-(propan-2-yloxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-chloro-3-propan-2-yloxybenzoic acid (CAS 1369785-64-7) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-chloro-3-propan-2-yloxybenzoic acid. InChIKey: NANUKPNCPFPTCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO3
Molecular weight214.64 g/mol
IUPAC name2-chloro-3-propan-2-yloxybenzoic acid
InChIKeyNANUKPNCPFPTCJ-UHFFFAOYSA-N
SMILESCC(C)OC1=CC=CC(=C1Cl)C(=O)O

Computed by PubChem (NCBI)