Products 13698-37-8
CAS 13698-37-8 is the registry number for (Z)-Pralidoxime Chloride. Offered by: Chemat Brand. Available pack sizes: on request.
(NZ)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine chloride (CAS 13698-37-8) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. IUPAC name: (NZ)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine chloride. InChIKey: HIGSLXSBYYMVKI-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | (NZ)-N-[(1-methylpyridin-1-ium-2-yl)methylidene]hydroxylamine chloride |
| InChIKey | HIGSLXSBYYMVKI-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=CC=C1/C=N\O.[Cl-] |
Computed by PubChem (NCBI)