CAS 63502-89-6 appears in our catalog under these names: 3-Hydroxybenzamidine hydrochloride, 95%, 3-Hydroxybenzamidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g.
3-hydroxybenzenecarboximidamide;hydrochloride (CAS 63502-89-6) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. IUPAC name: 3-hydroxybenzenecarboximidamide;hydrochloride. InChIKey: WAGGXXBNIACBLQ-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | 3-hydroxybenzenecarboximidamide;hydrochloride |
| InChIKey | WAGGXXBNIACBLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=N)N.Cl |
Computed by PubChem (NCBI)