Products 98298-63-6

CAS 98298-63-6 appears in our catalog under these names: 1,3,5-Trimethyl-1h-pyrazole-4-carbonyl chloride, 95%, 1,3,5-Trimethyl-1H-pyrazole-4-carbonyl chloride, 97%, 1,3,5-Trimethyl-1H-pyrazole-4-carbonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 1000mg, 2000mg.

Structural formula: {0} (CAS {1})

1,3,5-trimethylpyrazole-4-carbonyl chloride (CAS 98298-63-6) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. IUPAC name: 1,3,5-trimethylpyrazole-4-carbonyl chloride. InChIKey: UFNVZQRBSDFSPY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClN2O
Molecular weight172.61 g/mol
IUPAC name1,3,5-trimethylpyrazole-4-carbonyl chloride
InChIKeyUFNVZQRBSDFSPY-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C)C)C(=O)Cl

Computed by PubChem (NCBI)