Products 1369851-30-8
CAS 1369851-30-8 appears in our catalog under these names: 3,4-Bis(cyclopropylmethoxy)benzoic acid, 96%, 3,4-Bis(cyclopropylmethoxy)benzoic acid 97%, 3,4-Bis(cyclopropylmethoxy)benzoic acid, 99%, 99%, 3,4-Bis(cyclopropylmethoxy)benzoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
3,4-bis(cyclopropylmethoxy)benzoic acid (CAS 1369851-30-8) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: 3,4-bis(cyclopropylmethoxy)benzoic acid. InChIKey: FMGSFZUGHYOLAL-UHFFFAOYSA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 3,4-bis(cyclopropylmethoxy)benzoic acid |
| InChIKey | FMGSFZUGHYOLAL-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=C(C=C2)C(=O)O)OCC3CC3 |
Computed by PubChem (NCBI)