CAS 203870-51-3 appears in our catalog under these names: Ethyl 2,4-dioxo-4-(2,4,6-trimethylphenyl)butanoate, 95%, Ethyl 2,4-dioxo-4-(2,4,6-trimethylphenyl)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
Ethyl 2,4-dioxo-4-(2,4,6-trimethylphenyl)butanoate (CAS 203870-51-3) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: ethyl 2,4-dioxo-4-(2,4,6-trimethylphenyl)butanoate. InChIKey: HYNSQCXSPNYMPQ-UHFFFAOYSA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | ethyl 2,4-dioxo-4-(2,4,6-trimethylphenyl)butanoate |
| InChIKey | HYNSQCXSPNYMPQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=C(C=C(C=C1C)C)C |
Computed by PubChem (NCBI)