Products 2242606-39-7
CAS 2242606-39-7 is the registry number for Nicardipine Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-acetyl-5-oxo-3-phenylhexanoate (CAS 2242606-39-7) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: methyl 4-acetyl-5-oxo-3-phenylhexanoate. InChIKey: KGEGQJMDTDBNSX-UHFFFAOYSA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | methyl 4-acetyl-5-oxo-3-phenylhexanoate |
| InChIKey | KGEGQJMDTDBNSX-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C(CC(=O)OC)C1=CC=CC=C1)C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-acetyl-5-oxo-3-phenylhexanoate