Products 1369899-62-6
CAS 1369899-62-6 appears in our catalog under these names: 1-(tert-Butyl)-3,5-dichlorobenzene 95%, 1-(tert-butyl)-3,5-dichlorobenzene, 98%, 98%, 1-(Tert-butyl)-3,5-dichlorobenzene, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g.
1-tert-butyl-3,5-dichlorobenzene (CAS 1369899-62-6) is a chemical compound with the molecular formula C10H12Cl2 and a molecular weight of 203.10 g/mol. IUPAC name: 1-tert-butyl-3,5-dichlorobenzene. InChIKey: ZFHLUUHAMWNEJI-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 1-tert-butyl-3,5-dichlorobenzene |
| InChIKey | ZFHLUUHAMWNEJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(tert-butyl)-3,5-dichlorobenzene, 1-tert-butyl-3,5-dichlorobenzene, 1-(tert-Butyl )-3,5-dichlorobenzene, benzene, 1,3-dichloro-5-(1,1-dimethylethyl)-, 3,5-Dichloro-1-tert-butylbenzene, 1-(t-Butyl)-3,5-dichlorobenZene, 1-tert-butyl-3,5-dichloro-benzene, 1-(Tert-butyl)-3,5-dichlorobenzene - [B93937]