Products 1369915-63-8
CAS 1369915-63-8 appears in our catalog under these names: 3-tert-Butoxy-5-fluorobenzoic acid, 95%, 3-(tert-Butoxy)-5-fluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
3-fluoro-5-[(2-methylpropan-2-yl)oxy]benzoic acid (CAS 1369915-63-8) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: 3-fluoro-5-[(2-methylpropan-2-yl)oxy]benzoic acid. InChIKey: GSJUIDXAQUOVLM-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 3-fluoro-5-[(2-methylpropan-2-yl)oxy]benzoic acid |
| InChIKey | GSJUIDXAQUOVLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC(=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)