Products 1369928-45-9

CAS 1369928-45-9 is the registry number for 3-Isopropoxy-2-nitrobenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-nitro-3-propan-2-yloxybenzoic acid (CAS 1369928-45-9) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 2-nitro-3-propan-2-yloxybenzoic acid. InChIKey: XXWQJEUYDNGZQV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO5
Molecular weight225.20 g/mol
IUPAC name2-nitro-3-propan-2-yloxybenzoic acid
InChIKeyXXWQJEUYDNGZQV-UHFFFAOYSA-N
SMILESCC(C)OC1=CC=CC(=C1[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)