CAS 1369934-25-7 is the registry number for 4-(tert-Butoxy)-1,2-dimethylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]benzene (CAS 1369934-25-7) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 1,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: OVBKZUVKOWINRY-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 1,2-dimethyl-4-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | OVBKZUVKOWINRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(C)(C)C)C |
Computed by PubChem (NCBI)