CAS 137-65-5 appears in our catalog under these names: 2-Amino-5-sulfamoylbenzoic acid, 95+%, Furosemide Impurity 18. Offered by: AmBeed, Chemat Brand. Available pack sizes: 5g, on request.
2-amino-5-sulfamoylbenzoic acid (CAS 137-65-5) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: 2-amino-5-sulfamoylbenzoic acid. InChIKey: JRGAUAWPCLQHTF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 2-amino-5-sulfamoylbenzoic acid |
| InChIKey | JRGAUAWPCLQHTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)C(=O)O)N |
Computed by PubChem (NCBI)