CAS 13700-06-6 is the registry number for S-(2-Chloroethyl) 4-(acetylamino)benzenesulfonothioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[4-(2-chloroethylsulfanylsulfonyl)phenyl]acetamide (CAS 13700-06-6) is a chemical compound with the molecular formula C10H12ClNO3S2 and a molecular weight of 293.8 g/mol. IUPAC name: N-[4-(2-chloroethylsulfanylsulfonyl)phenyl]acetamide. InChIKey: KTWFVGIWJUUJCK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S2 |
|---|---|
| Molecular weight | 293.8 g/mol |
| IUPAC name | N-[4-(2-chloroethylsulfanylsulfonyl)phenyl]acetamide |
| InChIKey | KTWFVGIWJUUJCK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)SCCCl |
Computed by PubChem (NCBI)