Products 1423029-51-9

CAS 1423029-51-9 appears in our catalog under these names: 4-(Cyclopentylcarbamoyl)thiophene-2-sulfonyl chloride, 95%, 4-(Cyclopentylcarbamoyl)thiophene-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(cyclopentylcarbamoyl)thiophene-2-sulfonyl chloride (CAS 1423029-51-9) is a chemical compound with the molecular formula C10H12ClNO3S2 and a molecular weight of 293.8 g/mol. IUPAC name: 4-(cyclopentylcarbamoyl)thiophene-2-sulfonyl chloride. InChIKey: SSYOEPBMCHBXKG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO3S2
Molecular weight293.8 g/mol
IUPAC name4-(cyclopentylcarbamoyl)thiophene-2-sulfonyl chloride
InChIKeySSYOEPBMCHBXKG-UHFFFAOYSA-N
SMILESC1CCC(C1)NC(=O)C2=CSC(=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)