CAS 171273-34-0 appears in our catalog under these names: Brinzolamide Impurity 25, Brinzolamide Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-(3-methoxypropyl)thieno[3,2-e]thiazine 1,1-dioxide (CAS 171273-34-0) is a chemical compound with the molecular formula C10H12ClNO3S2 and a molecular weight of 293.8 g/mol. IUPAC name: 6-chloro-2-(3-methoxypropyl)thieno[3,2-e]thiazine 1,1-dioxide. InChIKey: SYJHCKFCVKSBRB-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3S2 |
|---|---|
| Molecular weight | 293.8 g/mol |
| IUPAC name | 6-chloro-2-(3-methoxypropyl)thieno[3,2-e]thiazine 1,1-dioxide |
| InChIKey | SYJHCKFCVKSBRB-UHFFFAOYSA-N |
| SMILES | COCCCN1C=CC2=C(S1(=O)=O)SC(=C2)Cl |
Computed by PubChem (NCBI)