Products 1370032-19-1
CAS 1370032-19-1 appears in our catalog under these names: Ca-5f, 95%, CA-5f/ 99.83% (existing batch purity), CA-5f 99+%, CA-5f, 99%, 99%, CA-5f, 99.14%. Offered by: Combi-blocks, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
(3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one (CAS 1370032-19-1) is a chemical compound with the molecular formula C24H24N2O3 and a molecular weight of 388.5 g/mol. IUPAC name: (3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one. InChIKey: JYOLPDWVAMBMQN-UBIAKTOFSA-N.
| Molecular formula | C24H24N2O3 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | (3E,5E)-3-[(3,4-dimethoxyphenyl)methylidene]-5-(1H-indol-3-ylmethylidene)-1-methylpiperidin-4-one |
| InChIKey | JYOLPDWVAMBMQN-UBIAKTOFSA-N |
| SMILES | CN1C/C(=C\C2=CC(=C(C=C2)OC)OC)/C(=O)/C(=C/C3=CNC4=CC=CC=C43)/C1 |
Computed by PubChem (NCBI)