CAS 200203-23-2 appears in our catalog under these names: H-D-Asn(mtt)-oh, 95%, (R)-2-Amino-4-((diphenyl(p-tolyl)methyl)amino)-4-oxobutanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(2R)-2-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxobutanoic acid (CAS 200203-23-2) is a chemical compound with the molecular formula C24H24N2O3 and a molecular weight of 388.5 g/mol. IUPAC name: (2R)-2-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxobutanoic acid. InChIKey: RSGFXZGZDIQYCG-OAQYLSRUSA-N.
| Molecular formula | C24H24N2O3 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | (2R)-2-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxobutanoic acid |
| InChIKey | RSGFXZGZDIQYCG-OAQYLSRUSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)