CAS 144317-20-4 appears in our catalog under these names: (S)-2-Amino-4-((diphenyl(p-tolyl)methyl)amino)-4-oxobutanoic acid, 95+%, H-Asn(mtt)-OH, 95%, H–Asn(Mtt)–OH. Offered by: AmBeed, Combi-blocks, GLPBio. Available pack sizes: 25g, 1g, 5g.
(2S)-2-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxobutanoic acid (CAS 144317-20-4) is a chemical compound with the molecular formula C24H24N2O3 and a molecular weight of 388.5 g/mol. IUPAC name: (2S)-2-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxobutanoic acid. InChIKey: RSGFXZGZDIQYCG-NRFANRHFSA-N.
| Molecular formula | C24H24N2O3 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | (2S)-2-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-4-oxobutanoic acid |
| InChIKey | RSGFXZGZDIQYCG-NRFANRHFSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)