Products 1370419-33-2
CAS 1370419-33-2 is the registry number for 1-(5-Chloro-3-fluoropyridin-2-yl)piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(5-chloro-3-fluoro-2-pyridinyl)piperazine (CAS 1370419-33-2) is a chemical compound with the molecular formula C9H11ClFN3 and a molecular weight of 215.65 g/mol. IUPAC name: 1-(5-chloro-3-fluoro-2-pyridinyl)piperazine. InChIKey: XNTJOMFXUNRNSQ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN3 |
|---|---|
| Molecular weight | 215.65 g/mol |
| IUPAC name | 1-(5-chloro-3-fluoro-2-pyridinyl)piperazine |
| InChIKey | XNTJOMFXUNRNSQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=N2)Cl)F |
Computed by PubChem (NCBI)