CAS 1423033-99-1 appears in our catalog under these names: 1-Ethyl-5-fluoro-1H-1,3-benzodiazol-2-amine hydrochloride, 95%, 1-Ethyl-5-fluoro-1H-1,3-benzodiazol-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-ethyl-5-fluorobenzimidazol-2-amine;hydrochloride (CAS 1423033-99-1) is a chemical compound with the molecular formula C9H11ClFN3 and a molecular weight of 215.65 g/mol. IUPAC name: 1-ethyl-5-fluorobenzimidazol-2-amine;hydrochloride. InChIKey: YPCCTSWIRVGILB-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN3 |
|---|---|
| Molecular weight | 215.65 g/mol |
| IUPAC name | 1-ethyl-5-fluorobenzimidazol-2-amine;hydrochloride |
| InChIKey | YPCCTSWIRVGILB-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)F)N=C1N.Cl |
Computed by PubChem (NCBI)