Products 2757730-00-8

CAS 2757730-00-8 is the registry number for 2-(6-Fluoro-1H-indazol-3-yl)ethanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(6-fluoro-2H-indazol-3-yl)ethanamine;hydrochloride (CAS 2757730-00-8) is a chemical compound with the molecular formula C9H11ClFN3 and a molecular weight of 215.65 g/mol. IUPAC name: 2-(6-fluoro-2H-indazol-3-yl)ethanamine;hydrochloride. InChIKey: JFYJJBMFMCAKNU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClFN3
Molecular weight215.65 g/mol
IUPAC name2-(6-fluoro-2H-indazol-3-yl)ethanamine;hydrochloride
InChIKeyJFYJJBMFMCAKNU-UHFFFAOYSA-N
SMILESC1=CC2=C(NN=C2C=C1F)CCN.Cl

Computed by PubChem (NCBI)